C9H15ClN2O4S2 — CID 106728498
2-methyl-1-(2-propylsulfonylethyl)imidazole-4-sulfonyl chloride (PubChem CID 106728498) has the molecular formula C9H15ClN2O4S2 and a molecular weight of 314.82 g/mol. Its IUPAC name is 2-methyl-1-(2-propylsulfonylethyl)imidazole-4-sulfonyl chloride.
| Compound Name | 2-methyl-1-(2-propylsulfonylethyl)imidazole-4-sulfonyl chloride |
|---|---|
| PubChem CID | 106728498 |
| Molecular Formula | C9H15ClN2O4S2 |
| Molecular Weight | 314.82 g/mol |
| Exact Mass | 314.02 |
| IUPAC Name | 2-methyl-1-(2-propylsulfonylethyl)imidazole-4-sulfonyl chloride |
| SMILES | CCCS(=O)(=O)CCn1cc(S(=O)(=O)Cl)nc1C |
| InChI | InChI=1S/C9H15ClN2O4S2/c1-3-5-17(13,14)6-4-12-7-9(11-8(12)2)18(10,15)16/h7H,3-6H2,1-2H3 |
| InChIKey | XSGJSUMWBARKOA-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 86.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.82 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |