C10H18ClN3O2S — CID 63396389
N-(2-chloroethyl)-N,2-dimethyl-1-propylimidazole-4-sulfonamide (PubChem CID 63396389) has the molecular formula C10H18ClN3O2S and a molecular weight of 279.79 g/mol. Its IUPAC name is N-(2-chloroethyl)-N,2-dimethyl-1-propylimidazole-4-sulfonamide.
| Compound Name | N-(2-chloroethyl)-N,2-dimethyl-1-propylimidazole-4-sulfonamide |
|---|---|
| PubChem CID | 63396389 |
| Molecular Formula | C10H18ClN3O2S |
| Molecular Weight | 279.79 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | N-(2-chloroethyl)-N,2-dimethyl-1-propylimidazole-4-sulfonamide |
| SMILES | CCCn1cc(S(=O)(=O)N(C)CCCl)nc1C |
| InChI | InChI=1S/C10H18ClN3O2S/c1-4-6-14-8-10(12-9(14)2)17(15,16)13(3)7-5-11/h8H,4-7H2,1-3H3 |
| InChIKey | SBWRNQOLEWILJN-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.79 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|