About N-(cyanomethyl)-N,2-dimethyl-1-propylimidazole-4-sulfonamide
N-(cyanomethyl)-N,2-dimethyl-1-propylimidazole-4-sulfonamide (PubChem CID 62064623) has the molecular formula C10H16N4O2S
and a molecular weight of 256.33 g/mol. Its IUPAC name is N-(cyanomethyl)-N,2-dimethyl-1-propylimidazole-4-sulfonamide.
Molecular Properties
| Compound Name | N-(cyanomethyl)-N,2-dimethyl-1-propylimidazole-4-sulfonamide |
| PubChem CID | 62064623 |
| Molecular Formula | C10H16N4O2S |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | N-(cyanomethyl)-N,2-dimethyl-1-propylimidazole-4-sulfonamide |
| SMILES | CCCn1cc(S(=O)(=O)N(C)CC#N)nc1C |
| InChI | InChI=1S/C10H16N4O2S/c1-4-6-14-8-10(12-9(14)2)17(15,16)13(3)7-5-11/h8H,4,6-7H2,1-3H3 |
| InChIKey | GCLKYMCZBFDSOS-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 78.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|
Analyze N-(cyanomethyl)-N,2-dimethyl-1-propylimidazole-4-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(cyanomethyl)-N,2-dimethyl-1-propylimidazole-4-sulfonamide?
The IUPAC name of N-(cyanomethyl)-N,2-dimethyl-1-propylimidazole-4-sulfonamide (CID 62064623) is N-(cyanomethyl)-N,2-dimethyl-1-propylimidazole-4-sulfonamide.
What is the SMILES notation for N-(cyanomethyl)-N,2-dimethyl-1-propylimidazole-4-sulfonamide?
The canonical SMILES for N-(cyanomethyl)-N,2-dimethyl-1-propylimidazole-4-sulfonamide is CCCn1cc(S(=O)(=O)N(C)CC#N)nc1C.
What is the InChIKey of N-(cyanomethyl)-N,2-dimethyl-1-propylimidazole-4-sulfonamide?
The InChIKey is GCLKYMCZBFDSOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N4O2S/c1-4-6-14-8-10(12-9(14)2)17(15,16)13(3)7-5-11/h8H,4,6-7H2,1-3H3.
What are the key properties of N-(cyanomethyl)-N,2-dimethyl-1-propylimidazole-4-sulfonamide?
N-(cyanomethyl)-N,2-dimethyl-1-propylimidazole-4-sulfonamide has a molecular weight of 256.33 g/mol, XLogP of 0.75, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(cyanomethyl)-N,2-dimethyl-1-propylimidazole-4-sulfonamide is sourced from PubChem (CID 62064623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).