C9H14N4O2S — CID 62062274
N-(2-cyanoethyl)-N,1,2-trimethylimidazole-4-sulfonamide (PubChem CID 62062274) has the molecular formula C9H14N4O2S and a molecular weight of 242.30 g/mol. Its IUPAC name is N-(2-cyanoethyl)-N,1,2-trimethylimidazole-4-sulfonamide.
| Compound Name | N-(2-cyanoethyl)-N,1,2-trimethylimidazole-4-sulfonamide |
|---|---|
| PubChem CID | 62062274 |
| Molecular Formula | C9H14N4O2S |
| Molecular Weight | 242.30 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | N-(2-cyanoethyl)-N,1,2-trimethylimidazole-4-sulfonamide |
| SMILES | Cc1nc(S(=O)(=O)N(C)CCC#N)cn1C |
| InChI | InChI=1S/C9H14N4O2S/c1-8-11-9(7-12(8)2)16(14,15)13(3)6-4-5-10/h7H,4,6H2,1-3H3 |
| InChIKey | AJMBOUDPCJJINM-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 78.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.30 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |