C14H20N4O2S — CID 62061953
N-(2-aminophenyl)-N,2-dimethyl-1-propylimidazole-4-sulfonamide (PubChem CID 62061953) has the molecular formula C14H20N4O2S and a molecular weight of 308.41 g/mol. Its IUPAC name is N-(2-aminophenyl)-N,2-dimethyl-1-propylimidazole-4-sulfonamide.
| Compound Name | N-(2-aminophenyl)-N,2-dimethyl-1-propylimidazole-4-sulfonamide |
|---|---|
| PubChem CID | 62061953 |
| Molecular Formula | C14H20N4O2S |
| Molecular Weight | 308.41 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | N-(2-aminophenyl)-N,2-dimethyl-1-propylimidazole-4-sulfonamide |
| SMILES | CCCn1cc(S(=O)(=O)N(C)c2ccccc2N)nc1C |
| InChI | InChI=1S/C14H20N4O2S/c1-4-9-18-10-14(16-11(18)2)21(19,20)17(3)13-8-6-5-7-12(13)15/h5-8,10H,4,9,15H2,1-3H3 |
| InChIKey | OYBMHIGCCZCZCI-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 81.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.41 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|