C10H20N6O — CID 107052565
5-[(dimethylamino)methyl]-1-[(2-methyltetrazol-5-yl)methyl]pyrrolidin-3-ol (PubChem CID 107052565) has the molecular formula C10H20N6O and a molecular weight of 240.31 g/mol. Its IUPAC name is 5-[(dimethylamino)methyl]-1-[(2-methyltetrazol-5-yl)methyl]pyrrolidin-3-ol.
| Compound Name | 5-[(dimethylamino)methyl]-1-[(2-methyltetrazol-5-yl)methyl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 107052565 |
| Molecular Formula | C10H20N6O |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.17 |
| IUPAC Name | 5-[(dimethylamino)methyl]-1-[(2-methyltetrazol-5-yl)methyl]pyrrolidin-3-ol |
| SMILES | CN(C)CC1CC(O)CN1Cc1nnn(C)n1 |
| InChI | InChI=1S/C10H20N6O/c1-14(2)5-8-4-9(17)6-16(8)7-10-11-13-15(3)12-10/h8-9,17H,4-7H2,1-3H3 |
| InChIKey | YAEPNJQUEQWSOW-UHFFFAOYSA-N |
| XLogP | -1.29 |
| TPSA | 70.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |