C10H20N6OS — CID 80614598
5-[(dimethylamino)methyl]-1-[(5-hydrazinyl-1,3,4-thiadiazol-2-yl)methyl]pyrrolidin-3-ol (PubChem CID 80614598) has the molecular formula C10H20N6OS and a molecular weight of 272.38 g/mol. Its IUPAC name is 5-[(dimethylamino)methyl]-1-[(5-hydrazinyl-1,3,4-thiadiazol-2-yl)methyl]pyrrolidin-3-ol.
| Compound Name | 5-[(dimethylamino)methyl]-1-[(5-hydrazinyl-1,3,4-thiadiazol-2-yl)methyl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 80614598 |
| Molecular Formula | C10H20N6OS |
| Molecular Weight | 272.38 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | 5-[(dimethylamino)methyl]-1-[(5-hydrazinyl-1,3,4-thiadiazol-2-yl)methyl]pyrrolidin-3-ol |
| SMILES | CN(C)CC1CC(O)CN1Cc1nnc(NN)s1 |
| InChI | InChI=1S/C10H20N6OS/c1-15(2)4-7-3-8(17)5-16(7)6-9-13-14-10(12-11)18-9/h7-8,17H,3-6,11H2,1-2H3,(H,12,14) |
| InChIKey | KIGQLUHZIFNSBL-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.38 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|