C14H17N5 — CID 107053881
2-[1-[(1-methyltriazol-4-yl)methyl]indol-6-yl]ethanamine (PubChem CID 107053881) has the molecular formula C14H17N5 and a molecular weight of 255.32 g/mol. Its IUPAC name is 2-[1-[(1-methyltriazol-4-yl)methyl]indol-6-yl]ethanamine.
| Compound Name | 2-[1-[(1-methyltriazol-4-yl)methyl]indol-6-yl]ethanamine |
|---|---|
| PubChem CID | 107053881 |
| Molecular Formula | C14H17N5 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.15 |
| IUPAC Name | 2-[1-[(1-methyltriazol-4-yl)methyl]indol-6-yl]ethanamine |
| SMILES | Cn1cc(Cn2ccc3ccc(CCN)cc32)nn1 |
| InChI | InChI=1S/C14H17N5/c1-18-9-13(16-17-18)10-19-7-5-12-3-2-11(4-6-15)8-14(12)19/h2-3,5,7-9H,4,6,10,15H2,1H3 |
| InChIKey | WCCMBCLEILTZMT-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 61.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|