C17H16Cl2N2 — CID 107309943
2-[1-[(2,3-dichlorophenyl)methyl]indol-6-yl]ethanamine (PubChem CID 107309943) has the molecular formula C17H16Cl2N2 and a molecular weight of 319.24 g/mol. Its IUPAC name is 2-[1-[(2,3-dichlorophenyl)methyl]indol-6-yl]ethanamine.
| Compound Name | 2-[1-[(2,3-dichlorophenyl)methyl]indol-6-yl]ethanamine |
|---|---|
| PubChem CID | 107309943 |
| Molecular Formula | C17H16Cl2N2 |
| Molecular Weight | 319.24 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | 2-[1-[(2,3-dichlorophenyl)methyl]indol-6-yl]ethanamine |
| SMILES | NCCc1ccc2ccn(Cc3cccc(Cl)c3Cl)c2c1 |
| InChI | InChI=1S/C17H16Cl2N2/c18-15-3-1-2-14(17(15)19)11-21-9-7-13-5-4-12(6-8-20)10-16(13)21/h1-5,7,9-10H,6,8,11,20H2 |
| InChIKey | KQAUIHGQSJLUOF-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.24 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|