C17H16Cl2N2 — CID 107307311
1-[1-[(2,3-dichlorophenyl)methyl]indol-5-yl]-N-methylmethanamine (PubChem CID 107307311) has the molecular formula C17H16Cl2N2 and a molecular weight of 319.24 g/mol. Its IUPAC name is 1-[1-[(2,3-dichlorophenyl)methyl]indol-5-yl]-N-methylmethanamine.
| Compound Name | 1-[1-[(2,3-dichlorophenyl)methyl]indol-5-yl]-N-methylmethanamine |
|---|---|
| PubChem CID | 107307311 |
| Molecular Formula | C17H16Cl2N2 |
| Molecular Weight | 319.24 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | 1-[1-[(2,3-dichlorophenyl)methyl]indol-5-yl]-N-methylmethanamine |
| SMILES | CNCc1ccc2c(ccn2Cc2cccc(Cl)c2Cl)c1 |
| InChI | InChI=1S/C17H16Cl2N2/c1-20-10-12-5-6-16-13(9-12)7-8-21(16)11-14-3-2-4-15(18)17(14)19/h2-9,20H,10-11H2,1H3 |
| InChIKey | NZYAWXSJNCQXND-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.24 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |