C12H12Cl2N2 — CID 107307260
[1-[(2,3-dichlorophenyl)methyl]pyrrol-2-yl]methanamine (PubChem CID 107307260) has the molecular formula C12H12Cl2N2 and a molecular weight of 255.15 g/mol. Its IUPAC name is [1-[(2,3-dichlorophenyl)methyl]pyrrol-2-yl]methanamine.
| Compound Name | [1-[(2,3-dichlorophenyl)methyl]pyrrol-2-yl]methanamine |
|---|---|
| PubChem CID | 107307260 |
| Molecular Formula | C12H12Cl2N2 |
| Molecular Weight | 255.15 g/mol |
| Exact Mass | 254.04 |
| IUPAC Name | [1-[(2,3-dichlorophenyl)methyl]pyrrol-2-yl]methanamine |
| SMILES | NCc1cccn1Cc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C12H12Cl2N2/c13-11-5-1-3-9(12(11)14)8-16-6-2-4-10(16)7-15/h1-6H,7-8,15H2 |
| InChIKey | OLSVHGKYZGNJQP-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.15 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |