C12H16FN5O — CID 107053917
2-(aminomethyl)-2-(2-fluorophenyl)-3-(2-methyltetrazol-5-yl)propan-1-ol (PubChem CID 107053917) has the molecular formula C12H16FN5O and a molecular weight of 265.29 g/mol. Its IUPAC name is 2-(aminomethyl)-2-(2-fluorophenyl)-3-(2-methyltetrazol-5-yl)propan-1-ol.
| Compound Name | 2-(aminomethyl)-2-(2-fluorophenyl)-3-(2-methyltetrazol-5-yl)propan-1-ol |
|---|---|
| PubChem CID | 107053917 |
| Molecular Formula | C12H16FN5O |
| Molecular Weight | 265.29 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | 2-(aminomethyl)-2-(2-fluorophenyl)-3-(2-methyltetrazol-5-yl)propan-1-ol |
| SMILES | Cn1nnc(CC(CN)(CO)c2ccccc2F)n1 |
| InChI | InChI=1S/C12H16FN5O/c1-18-16-11(15-17-18)6-12(7-14,8-19)9-4-2-3-5-10(9)13/h2-5,19H,6-8,14H2,1H3 |
| InChIKey | PORVASFVDVQDDQ-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 89.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.29 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |