C6H7N5OS — CID 107054418
3-[(2-methyltetrazol-5-yl)methyl]-1,3-thiazol-2-one (PubChem CID 107054418) has the molecular formula C6H7N5OS and a molecular weight of 197.22 g/mol. Its IUPAC name is 3-[(2-methyltetrazol-5-yl)methyl]-1,3-thiazol-2-one.
| Compound Name | 3-[(2-methyltetrazol-5-yl)methyl]-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 107054418 |
| Molecular Formula | C6H7N5OS |
| Molecular Weight | 197.22 g/mol |
| Exact Mass | 197.04 |
| IUPAC Name | 3-[(2-methyltetrazol-5-yl)methyl]-1,3-thiazol-2-one |
| SMILES | Cn1nnc(Cn2ccsc2=O)n1 |
| InChI | InChI=1S/C6H7N5OS/c1-10-8-5(7-9-10)4-11-2-3-13-6(11)12/h2-3H,4H2,1H3 |
| InChIKey | CKRLXAMDKYICNQ-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 65.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.22 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |