C11H15N3OS — CID 116622684
3-[(1,3-diethylpyrazol-5-yl)methyl]-1,3-thiazol-2-one (PubChem CID 116622684) has the molecular formula C11H15N3OS and a molecular weight of 237.33 g/mol. Its IUPAC name is 3-[(1,3-diethylpyrazol-5-yl)methyl]-1,3-thiazol-2-one.
| Compound Name | 3-[(1,3-diethylpyrazol-5-yl)methyl]-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 116622684 |
| Molecular Formula | C11H15N3OS |
| Molecular Weight | 237.33 g/mol |
| Exact Mass | 237.09 |
| IUPAC Name | 3-[(1,3-diethylpyrazol-5-yl)methyl]-1,3-thiazol-2-one |
| SMILES | CCc1cc(Cn2ccsc2=O)n(CC)n1 |
| InChI | InChI=1S/C11H15N3OS/c1-3-9-7-10(14(4-2)12-9)8-13-5-6-16-11(13)15/h5-7H,3-4,8H2,1-2H3 |
| InChIKey | JXVOOHBOIGNIDW-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 39.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.33 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |