C10H18N4O — CID 107054806
2,2-dimethyl-6-(2-methyltetrazol-5-yl)hexan-3-one (PubChem CID 107054806) has the molecular formula C10H18N4O and a molecular weight of 210.28 g/mol. Its IUPAC name is 2,2-dimethyl-6-(2-methyltetrazol-5-yl)hexan-3-one.
| Compound Name | 2,2-dimethyl-6-(2-methyltetrazol-5-yl)hexan-3-one |
|---|---|
| PubChem CID | 107054806 |
| Molecular Formula | C10H18N4O |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.15 |
| IUPAC Name | 2,2-dimethyl-6-(2-methyltetrazol-5-yl)hexan-3-one |
| SMILES | Cn1nnc(CCCC(=O)C(C)(C)C)n1 |
| InChI | InChI=1S/C10H18N4O/c1-10(2,3)8(15)6-5-7-9-11-13-14(4)12-9/h5-7H2,1-4H3 |
| InChIKey | LRDUVWKPOAQWDN-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |