C13H28O2Si — CID 10705491
hydroxy-dimethyl-(1-pent-4-en-2-yloxyhexyl)silane (PubChem CID 10705491) has the molecular formula C13H28O2Si and a molecular weight of 244.45 g/mol. Its IUPAC name is hydroxy-dimethyl-(1-pent-4-en-2-yloxyhexyl)silane.
| Compound Name | hydroxy-dimethyl-(1-pent-4-en-2-yloxyhexyl)silane |
|---|---|
| PubChem CID | 10705491 |
| Molecular Formula | C13H28O2Si |
| Molecular Weight | 244.45 g/mol |
| Exact Mass | 244.19 |
| IUPAC Name | hydroxy-dimethyl-(1-pent-4-en-2-yloxyhexyl)silane |
| SMILES | C=CCC(C)OC(CCCCC)[Si](C)(C)O |
| InChI | InChI=1S/C13H28O2Si/c1-6-8-9-11-13(16(4,5)14)15-12(3)10-7-2/h7,12-14H,2,6,8-11H2,1,3-5H3 |
| InChIKey | LRFZJORMCLFUGG-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.45 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|