C12H13Cl2N3S — CID 107055274
4-(aminomethyl)-3-chloro-N-[(5-chlorothiophen-2-yl)methyl]-N-methylpyridin-2-amine (PubChem CID 107055274) has the molecular formula C12H13Cl2N3S and a molecular weight of 302.23 g/mol. Its IUPAC name is 4-(aminomethyl)-3-chloro-N-[(5-chlorothiophen-2-yl)methyl]-N-methylpyridin-2-amine.
| Compound Name | 4-(aminomethyl)-3-chloro-N-[(5-chlorothiophen-2-yl)methyl]-N-methylpyridin-2-amine |
|---|---|
| PubChem CID | 107055274 |
| Molecular Formula | C12H13Cl2N3S |
| Molecular Weight | 302.23 g/mol |
| Exact Mass | 301.02 |
| IUPAC Name | 4-(aminomethyl)-3-chloro-N-[(5-chlorothiophen-2-yl)methyl]-N-methylpyridin-2-amine |
| SMILES | CN(Cc1ccc(Cl)s1)c1nccc(CN)c1Cl |
| InChI | InChI=1S/C12H13Cl2N3S/c1-17(7-9-2-3-10(13)18-9)12-11(14)8(6-15)4-5-16-12/h2-5H,6-7,15H2,1H3 |
| InChIKey | XBMHTCORUZCUNQ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.23 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |