C11H18ClN3 — CID 107055114
4-(aminomethyl)-N-butan-2-yl-3-chloro-N-methylpyridin-2-amine (PubChem CID 107055114) has the molecular formula C11H18ClN3 and a molecular weight of 227.74 g/mol. Its IUPAC name is 4-(aminomethyl)-N-butan-2-yl-3-chloro-N-methylpyridin-2-amine.
| Compound Name | 4-(aminomethyl)-N-butan-2-yl-3-chloro-N-methylpyridin-2-amine |
|---|---|
| PubChem CID | 107055114 |
| Molecular Formula | C11H18ClN3 |
| Molecular Weight | 227.74 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | 4-(aminomethyl)-N-butan-2-yl-3-chloro-N-methylpyridin-2-amine |
| SMILES | CCC(C)N(C)c1nccc(CN)c1Cl |
| InChI | InChI=1S/C11H18ClN3/c1-4-8(2)15(3)11-10(12)9(7-13)5-6-14-11/h5-6,8H,4,7,13H2,1-3H3 |
| InChIKey | VNHITKIKBTUCTH-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.74 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |