C13H17ClN4 — CID 107057707
3-chloro-2-[methyl-[(1-methylpyrrolidin-3-yl)methyl]amino]pyridine-4-carbonitrile (PubChem CID 107057707) has the molecular formula C13H17ClN4 and a molecular weight of 264.76 g/mol. Its IUPAC name is 3-chloro-2-[methyl-[(1-methylpyrrolidin-3-yl)methyl]amino]pyridine-4-carbonitrile.
| Compound Name | 3-chloro-2-[methyl-[(1-methylpyrrolidin-3-yl)methyl]amino]pyridine-4-carbonitrile |
|---|---|
| PubChem CID | 107057707 |
| Molecular Formula | C13H17ClN4 |
| Molecular Weight | 264.76 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | 3-chloro-2-[methyl-[(1-methylpyrrolidin-3-yl)methyl]amino]pyridine-4-carbonitrile |
| SMILES | CN1CCC(CN(C)c2nccc(C#N)c2Cl)C1 |
| InChI | InChI=1S/C13H17ClN4/c1-17-6-4-10(8-17)9-18(2)13-12(14)11(7-15)3-5-16-13/h3,5,10H,4,6,8-9H2,1-2H3 |
| InChIKey | FGGAJUFTGLPUJR-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 43.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.76 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |