C13H18N4 — CID 63274025
2-[methyl-[(1-methylpyrrolidin-3-yl)methyl]amino]pyridine-4-carbonitrile (PubChem CID 63274025) has the molecular formula C13H18N4 and a molecular weight of 230.31 g/mol. Its IUPAC name is 2-[methyl-[(1-methylpyrrolidin-3-yl)methyl]amino]pyridine-4-carbonitrile.
| Compound Name | 2-[methyl-[(1-methylpyrrolidin-3-yl)methyl]amino]pyridine-4-carbonitrile |
|---|---|
| PubChem CID | 63274025 |
| Molecular Formula | C13H18N4 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | 2-[methyl-[(1-methylpyrrolidin-3-yl)methyl]amino]pyridine-4-carbonitrile |
| SMILES | CN1CCC(CN(C)c2cc(C#N)ccn2)C1 |
| InChI | InChI=1S/C13H18N4/c1-16-6-4-12(9-16)10-17(2)13-7-11(8-14)3-5-15-13/h3,5,7,12H,4,6,9-10H2,1-2H3 |
| InChIKey | XPTRZDYNVSBHOM-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 43.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |