C10H18Br2N4 — CID 107058528
5-[2,2-bis(bromomethyl)-4-methylpentyl]-2-methyltetrazole (PubChem CID 107058528) has the molecular formula C10H18Br2N4 and a molecular weight of 354.09 g/mol. Its IUPAC name is 5-[2,2-bis(bromomethyl)-4-methylpentyl]-2-methyltetrazole.
| Compound Name | 5-[2,2-bis(bromomethyl)-4-methylpentyl]-2-methyltetrazole |
|---|---|
| PubChem CID | 107058528 |
| Molecular Formula | C10H18Br2N4 |
| Molecular Weight | 354.09 g/mol |
| Exact Mass | 351.99 |
| IUPAC Name | 5-[2,2-bis(bromomethyl)-4-methylpentyl]-2-methyltetrazole |
| SMILES | CC(C)CC(CBr)(CBr)Cc1nnn(C)n1 |
| InChI | InChI=1S/C10H18Br2N4/c1-8(2)4-10(6-11,7-12)5-9-13-15-16(3)14-9/h8H,4-7H2,1-3H3 |
| InChIKey | XLDRBPKLMATEBX-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.09 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|