C14H11ClN2O3 — CID 107058963
3-chloro-2-(3,5-dimethoxyphenoxy)pyridine-4-carbonitrile (PubChem CID 107058963) has the molecular formula C14H11ClN2O3 and a molecular weight of 290.71 g/mol. Its IUPAC name is 3-chloro-2-(3,5-dimethoxyphenoxy)pyridine-4-carbonitrile.
| Compound Name | 3-chloro-2-(3,5-dimethoxyphenoxy)pyridine-4-carbonitrile |
|---|---|
| PubChem CID | 107058963 |
| Molecular Formula | C14H11ClN2O3 |
| Molecular Weight | 290.71 g/mol |
| Exact Mass | 290.05 |
| IUPAC Name | 3-chloro-2-(3,5-dimethoxyphenoxy)pyridine-4-carbonitrile |
| SMILES | COc1cc(OC)cc(Oc2nccc(C#N)c2Cl)c1 |
| InChI | InChI=1S/C14H11ClN2O3/c1-18-10-5-11(19-2)7-12(6-10)20-14-13(15)9(8-16)3-4-17-14/h3-7H,1-2H3 |
| InChIKey | MRAUVBVNFLAZAN-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 64.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.71 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |