C12H5Cl3N2O — CID 107058848
3-chloro-2-(2,4-dichlorophenoxy)pyridine-4-carbonitrile (PubChem CID 107058848) has the molecular formula C12H5Cl3N2O and a molecular weight of 299.54 g/mol. Its IUPAC name is 3-chloro-2-(2,4-dichlorophenoxy)pyridine-4-carbonitrile.
| Compound Name | 3-chloro-2-(2,4-dichlorophenoxy)pyridine-4-carbonitrile |
|---|---|
| PubChem CID | 107058848 |
| Molecular Formula | C12H5Cl3N2O |
| Molecular Weight | 299.54 g/mol |
| Exact Mass | 297.95 |
| IUPAC Name | 3-chloro-2-(2,4-dichlorophenoxy)pyridine-4-carbonitrile |
| SMILES | N#Cc1ccnc(Oc2ccc(Cl)cc2Cl)c1Cl |
| InChI | InChI=1S/C12H5Cl3N2O/c13-8-1-2-10(9(14)5-8)18-12-11(15)7(6-16)3-4-17-12/h1-5H |
| InChIKey | UYOOTBQVFAXGKC-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 45.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.54 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |