C11H5Cl2N3O — CID 80510174
3-(2,4-dichlorophenoxy)pyridazine-4-carbonitrile (PubChem CID 80510174) has the molecular formula C11H5Cl2N3O and a molecular weight of 266.09 g/mol. Its IUPAC name is 3-(2,4-dichlorophenoxy)pyridazine-4-carbonitrile.
| Compound Name | 3-(2,4-dichlorophenoxy)pyridazine-4-carbonitrile |
|---|---|
| PubChem CID | 80510174 |
| Molecular Formula | C11H5Cl2N3O |
| Molecular Weight | 266.09 g/mol |
| Exact Mass | 264.98 |
| IUPAC Name | 3-(2,4-dichlorophenoxy)pyridazine-4-carbonitrile |
| SMILES | N#Cc1ccnnc1Oc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C11H5Cl2N3O/c12-8-1-2-10(9(13)5-8)17-11-7(6-14)3-4-15-16-11/h1-5H |
| InChIKey | ZOEAXPNVUFUMMO-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 58.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.09 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |