About dec-9-enyl (E)-hex-3-enoate
dec-9-enyl (E)-hex-3-enoate (PubChem CID 10706003) has the molecular formula C16H28O2
and a molecular weight of 252.40 g/mol. Its IUPAC name is dec-9-enyl (E)-hex-3-enoate.
Molecular Properties
| Compound Name | dec-9-enyl (E)-hex-3-enoate |
| PubChem CID | 10706003 |
| Molecular Formula | C16H28O2 |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.21 |
| IUPAC Name | dec-9-enyl (E)-hex-3-enoate |
| SMILES | C=CCCCCCCCCOC(=O)C/C=C/CC |
| InChI | InChI=1S/C16H28O2/c1-3-5-7-8-9-10-11-13-15-18-16(17)14-12-6-4-2/h3,6,12H,1,4-5,7-11,13-15H2,2H3/b12-6+ |
| InChIKey | VITFGUFRLJRLAY-WUXMJOGZSA-N |
| XLogP | 4.80 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze dec-9-enyl (E)-hex-3-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dec-9-enyl (E)-hex-3-enoate?
The IUPAC name of dec-9-enyl (E)-hex-3-enoate (CID 10706003) is dec-9-enyl (E)-hex-3-enoate.
What is the SMILES notation for dec-9-enyl (E)-hex-3-enoate?
The canonical SMILES for dec-9-enyl (E)-hex-3-enoate is C=CCCCCCCCCOC(=O)C/C=C/CC.
What is the InChIKey of dec-9-enyl (E)-hex-3-enoate?
The InChIKey is VITFGUFRLJRLAY-WUXMJOGZSA-N. The full InChI is InChI=1S/C16H28O2/c1-3-5-7-8-9-10-11-13-15-18-16(17)14-12-6-4-2/h3,6,12H,1,4-5,7-11,13-15H2,2H3/b12-6+.
What are the key properties of dec-9-enyl (E)-hex-3-enoate?
dec-9-enyl (E)-hex-3-enoate has a molecular weight of 252.40 g/mol, XLogP of 4.80, 12 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dec-9-enyl (E)-hex-3-enoate is sourced from PubChem (CID 10706003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).