C16H17ClN4 — CID 107060313
3-chloro-2-(1,2,4,5-tetrahydro-3-benzazepin-3-yl)pyridine-4-carboximidamide (PubChem CID 107060313) has the molecular formula C16H17ClN4 and a molecular weight of 300.79 g/mol. Its IUPAC name is 3-chloro-2-(1,2,4,5-tetrahydro-3-benzazepin-3-yl)pyridine-4-carboximidamide.
| Compound Name | 3-chloro-2-(1,2,4,5-tetrahydro-3-benzazepin-3-yl)pyridine-4-carboximidamide |
|---|---|
| PubChem CID | 107060313 |
| Molecular Formula | C16H17ClN4 |
| Molecular Weight | 300.79 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | 3-chloro-2-(1,2,4,5-tetrahydro-3-benzazepin-3-yl)pyridine-4-carboximidamide |
| SMILES | [H]/N=C(\N)c1ccnc(N2CCc3ccccc3CC2)c1Cl |
| InChI | InChI=1S/C16H17ClN4/c17-14-13(15(18)19)5-8-20-16(14)21-9-6-11-3-1-2-4-12(11)7-10-21/h1-5,8H,6-7,9-10H2,(H3,18,19) |
| InChIKey | WTJXJYNYCVUHLX-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 66.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.79 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|