C17H18ClN3 — CID 63153099
5-chloro-2-(1,3,4,5-tetrahydro-2-benzazepin-2-yl)benzenecarboximidamide (PubChem CID 63153099) has the molecular formula C17H18ClN3 and a molecular weight of 299.81 g/mol. Its IUPAC name is 5-chloro-2-(1,3,4,5-tetrahydro-2-benzazepin-2-yl)benzenecarboximidamide.
| Compound Name | 5-chloro-2-(1,3,4,5-tetrahydro-2-benzazepin-2-yl)benzenecarboximidamide |
|---|---|
| PubChem CID | 63153099 |
| Molecular Formula | C17H18ClN3 |
| Molecular Weight | 299.81 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | 5-chloro-2-(1,3,4,5-tetrahydro-2-benzazepin-2-yl)benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cc(Cl)ccc1N1CCCc2ccccc2C1 |
| InChI | InChI=1S/C17H18ClN3/c18-14-7-8-16(15(10-14)17(19)20)21-9-3-6-12-4-1-2-5-13(12)11-21/h1-2,4-5,7-8,10H,3,6,9,11H2,(H3,19,20) |
| InChIKey | UFVZTOIMAIERQK-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.81 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|