C18H12N4O2 — CID 1070609
N-(2,1,3-benzoxadiazol-4-ylmethylideneamino)naphthalene-1-carboxamide (PubChem CID 1070609) has the molecular formula C18H12N4O2 and a molecular weight of 316.32 g/mol. Its IUPAC name is N-(2,1,3-benzoxadiazol-4-ylmethylideneamino)naphthalene-1-carboxamide.
| Compound Name | N-(2,1,3-benzoxadiazol-4-ylmethylideneamino)naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 1070609 |
| Molecular Formula | C18H12N4O2 |
| Molecular Weight | 316.32 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | N-(2,1,3-benzoxadiazol-4-ylmethylideneamino)naphthalene-1-carboxamide |
| SMILES | O=C(NN=Cc1cccc2nonc12)c1cccc2ccccc12 |
| InChI | InChI=1S/C18H12N4O2/c23-18(15-9-3-6-12-5-1-2-8-14(12)15)20-19-11-13-7-4-10-16-17(13)22-24-21-16/h1-11H,(H,20,23) |
| InChIKey | CBRIZPFHSLQGSH-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 80.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.32 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|