C11H13ClN4 — CID 107061376
2-[2-(aminomethyl)pyrrolidin-1-yl]-3-chloropyridine-4-carbonitrile (PubChem CID 107061376) has the molecular formula C11H13ClN4 and a molecular weight of 236.71 g/mol. Its IUPAC name is 2-[2-(aminomethyl)pyrrolidin-1-yl]-3-chloropyridine-4-carbonitrile.
| Compound Name | 2-[2-(aminomethyl)pyrrolidin-1-yl]-3-chloropyridine-4-carbonitrile |
|---|---|
| PubChem CID | 107061376 |
| Molecular Formula | C11H13ClN4 |
| Molecular Weight | 236.71 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | 2-[2-(aminomethyl)pyrrolidin-1-yl]-3-chloropyridine-4-carbonitrile |
| SMILES | N#Cc1ccnc(N2CCCC2CN)c1Cl |
| InChI | InChI=1S/C11H13ClN4/c12-10-8(6-13)3-4-15-11(10)16-5-1-2-9(16)7-14/h3-4,9H,1-2,5,7,14H2 |
| InChIKey | DULCNUDHMUKKIV-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 65.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.71 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |