C9H11BrN4O — CID 107064617
1-(2-bromofuran-3-yl)-2-(1-methyltriazol-4-yl)ethanamine (PubChem CID 107064617) has the molecular formula C9H11BrN4O and a molecular weight of 271.12 g/mol. Its IUPAC name is 1-(2-bromofuran-3-yl)-2-(1-methyltriazol-4-yl)ethanamine.
| Compound Name | 1-(2-bromofuran-3-yl)-2-(1-methyltriazol-4-yl)ethanamine |
|---|---|
| PubChem CID | 107064617 |
| Molecular Formula | C9H11BrN4O |
| Molecular Weight | 271.12 g/mol |
| Exact Mass | 270.01 |
| IUPAC Name | 1-(2-bromofuran-3-yl)-2-(1-methyltriazol-4-yl)ethanamine |
| SMILES | Cn1cc(CC(N)c2ccoc2Br)nn1 |
| InChI | InChI=1S/C9H11BrN4O/c1-14-5-6(12-13-14)4-8(11)7-2-3-15-9(7)10/h2-3,5,8H,4,11H2,1H3 |
| InChIKey | XNTKHZLMTYQRQQ-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 69.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.12 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |