C11H12BrFN4 — CID 107063908
1-(2-bromo-4-fluorophenyl)-2-(1-methyltriazol-4-yl)ethanamine (PubChem CID 107063908) has the molecular formula C11H12BrFN4 and a molecular weight of 299.15 g/mol. Its IUPAC name is 1-(2-bromo-4-fluorophenyl)-2-(1-methyltriazol-4-yl)ethanamine.
| Compound Name | 1-(2-bromo-4-fluorophenyl)-2-(1-methyltriazol-4-yl)ethanamine |
|---|---|
| PubChem CID | 107063908 |
| Molecular Formula | C11H12BrFN4 |
| Molecular Weight | 299.15 g/mol |
| Exact Mass | 298.02 |
| IUPAC Name | 1-(2-bromo-4-fluorophenyl)-2-(1-methyltriazol-4-yl)ethanamine |
| SMILES | Cn1cc(CC(N)c2ccc(F)cc2Br)nn1 |
| InChI | InChI=1S/C11H12BrFN4/c1-17-6-8(15-16-17)5-11(14)9-3-2-7(13)4-10(9)12/h2-4,6,11H,5,14H2,1H3 |
| InChIKey | AMLKJOJZLSVOLS-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.15 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |