C11H23N5 — CID 107064998
N,3-diethyl-1-(2-methyltetrazol-5-yl)pentan-2-amine (PubChem CID 107064998) has the molecular formula C11H23N5 and a molecular weight of 225.34 g/mol. Its IUPAC name is N,3-diethyl-1-(2-methyltetrazol-5-yl)pentan-2-amine.
| Compound Name | N,3-diethyl-1-(2-methyltetrazol-5-yl)pentan-2-amine |
|---|---|
| PubChem CID | 107064998 |
| Molecular Formula | C11H23N5 |
| Molecular Weight | 225.34 g/mol |
| Exact Mass | 225.20 |
| IUPAC Name | N,3-diethyl-1-(2-methyltetrazol-5-yl)pentan-2-amine |
| SMILES | CCNC(Cc1nnn(C)n1)C(CC)CC |
| InChI | InChI=1S/C11H23N5/c1-5-9(6-2)10(12-7-3)8-11-13-15-16(4)14-11/h9-10,12H,5-8H2,1-4H3 |
| InChIKey | QIYLAMVSCZRNCH-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.34 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |