C8H17N5 — CID 107044611
N,3-dimethyl-4-(2-methyltetrazol-5-yl)butan-2-amine (PubChem CID 107044611) has the molecular formula C8H17N5 and a molecular weight of 183.26 g/mol. Its IUPAC name is N,3-dimethyl-4-(2-methyltetrazol-5-yl)butan-2-amine.
| Compound Name | N,3-dimethyl-4-(2-methyltetrazol-5-yl)butan-2-amine |
|---|---|
| PubChem CID | 107044611 |
| Molecular Formula | C8H17N5 |
| Molecular Weight | 183.26 g/mol |
| Exact Mass | 183.15 |
| IUPAC Name | N,3-dimethyl-4-(2-methyltetrazol-5-yl)butan-2-amine |
| SMILES | CNC(C)C(C)Cc1nnn(C)n1 |
| InChI | InChI=1S/C8H17N5/c1-6(7(2)9-3)5-8-10-12-13(4)11-8/h6-7,9H,5H2,1-4H3 |
| InChIKey | OUBNSUGHBZRMOV-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.26 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |