C8H13N7 — CID 107050353
1-(1H-imidazol-2-yl)-N-methyl-2-(2-methyltetrazol-5-yl)ethanamine (PubChem CID 107050353) has the molecular formula C8H13N7 and a molecular weight of 207.24 g/mol. Its IUPAC name is 1-(1H-imidazol-2-yl)-N-methyl-2-(2-methyltetrazol-5-yl)ethanamine.
| Compound Name | 1-(1H-imidazol-2-yl)-N-methyl-2-(2-methyltetrazol-5-yl)ethanamine |
|---|---|
| PubChem CID | 107050353 |
| Molecular Formula | C8H13N7 |
| Molecular Weight | 207.24 g/mol |
| Exact Mass | 207.12 |
| IUPAC Name | 1-(1H-imidazol-2-yl)-N-methyl-2-(2-methyltetrazol-5-yl)ethanamine |
| SMILES | CNC(Cc1nnn(C)n1)c1ncc[nH]1 |
| InChI | InChI=1S/C8H13N7/c1-9-6(8-10-3-4-11-8)5-7-12-14-15(2)13-7/h3-4,6,9H,5H2,1-2H3,(H,10,11) |
| InChIKey | JIYNWQBLZWVOSU-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 84.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.24 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |