C14H22N6 — CID 107065461
1-(2-methyltetrazol-5-yl)-N-propyl-4-pyridin-4-ylbutan-2-amine (PubChem CID 107065461) has the molecular formula C14H22N6 and a molecular weight of 274.37 g/mol. Its IUPAC name is 1-(2-methyltetrazol-5-yl)-N-propyl-4-pyridin-4-ylbutan-2-amine.
| Compound Name | 1-(2-methyltetrazol-5-yl)-N-propyl-4-pyridin-4-ylbutan-2-amine |
|---|---|
| PubChem CID | 107065461 |
| Molecular Formula | C14H22N6 |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.19 |
| IUPAC Name | 1-(2-methyltetrazol-5-yl)-N-propyl-4-pyridin-4-ylbutan-2-amine |
| SMILES | CCCNC(CCc1ccncc1)Cc1nnn(C)n1 |
| InChI | InChI=1S/C14H22N6/c1-3-8-16-13(11-14-17-19-20(2)18-14)5-4-12-6-9-15-10-7-12/h6-7,9-10,13,16H,3-5,8,11H2,1-2H3 |
| InChIKey | ZBLHDYMVVRTCJM-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |