C9H11ClN4OS — CID 107065771
1-(3-chloro-4-methylthiophen-2-yl)-2-(2-methyltetrazol-5-yl)ethanol (PubChem CID 107065771) has the molecular formula C9H11ClN4OS and a molecular weight of 258.73 g/mol. Its IUPAC name is 1-(3-chloro-4-methylthiophen-2-yl)-2-(2-methyltetrazol-5-yl)ethanol.
| Compound Name | 1-(3-chloro-4-methylthiophen-2-yl)-2-(2-methyltetrazol-5-yl)ethanol |
|---|---|
| PubChem CID | 107065771 |
| Molecular Formula | C9H11ClN4OS |
| Molecular Weight | 258.73 g/mol |
| Exact Mass | 258.03 |
| IUPAC Name | 1-(3-chloro-4-methylthiophen-2-yl)-2-(2-methyltetrazol-5-yl)ethanol |
| SMILES | Cc1csc(C(O)Cc2nnn(C)n2)c1Cl |
| InChI | InChI=1S/C9H11ClN4OS/c1-5-4-16-9(8(5)10)6(15)3-7-11-13-14(2)12-7/h4,6,15H,3H2,1-2H3 |
| InChIKey | OUAUYVIAFKIAFH-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.73 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |