C10H17ClN2O — CID 107068571
N-(2-chloroprop-2-enyl)-3-methylpiperidine-2-carboxamide (PubChem CID 107068571) has the molecular formula C10H17ClN2O and a molecular weight of 216.71 g/mol. Its IUPAC name is N-(2-chloroprop-2-enyl)-3-methylpiperidine-2-carboxamide.
| Compound Name | N-(2-chloroprop-2-enyl)-3-methylpiperidine-2-carboxamide |
|---|---|
| PubChem CID | 107068571 |
| Molecular Formula | C10H17ClN2O |
| Molecular Weight | 216.71 g/mol |
| Exact Mass | 216.10 |
| IUPAC Name | N-(2-chloroprop-2-enyl)-3-methylpiperidine-2-carboxamide |
| SMILES | C=C(Cl)CNC(=O)C1NCCCC1C |
| InChI | InChI=1S/C10H17ClN2O/c1-7-4-3-5-12-9(7)10(14)13-6-8(2)11/h7,9,12H,2-6H2,1H3,(H,13,14) |
| InChIKey | NNBZAGPVXCGTFU-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.71 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |