C10H20N2O3 — CID 107068312
N-(2,3-dihydroxypropyl)-3-methylpiperidine-2-carboxamide (PubChem CID 107068312) has the molecular formula C10H20N2O3 and a molecular weight of 216.28 g/mol. Its IUPAC name is N-(2,3-dihydroxypropyl)-3-methylpiperidine-2-carboxamide.
| Compound Name | N-(2,3-dihydroxypropyl)-3-methylpiperidine-2-carboxamide |
|---|---|
| PubChem CID | 107068312 |
| Molecular Formula | C10H20N2O3 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | N-(2,3-dihydroxypropyl)-3-methylpiperidine-2-carboxamide |
| SMILES | CC1CCCNC1C(=O)NCC(O)CO |
| InChI | InChI=1S/C10H20N2O3/c1-7-3-2-4-11-9(7)10(15)12-5-8(14)6-13/h7-9,11,13-14H,2-6H2,1H3,(H,12,15) |
| InChIKey | IZLJXHALJHRTGG-UHFFFAOYSA-N |
| XLogP | -1.16 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |