C8H15NO3 — CID 165487313
N-[(2R)-2,3-dihydroxypropyl]cyclobutanecarboxamide (PubChem CID 165487313) has the molecular formula C8H15NO3 and a molecular weight of 173.21 g/mol. Its IUPAC name is N-[(2R)-2,3-dihydroxypropyl]cyclobutanecarboxamide.
| Compound Name | N-[(2R)-2,3-dihydroxypropyl]cyclobutanecarboxamide |
|---|---|
| PubChem CID | 165487313 |
| Molecular Formula | C8H15NO3 |
| Molecular Weight | 173.21 g/mol |
| Exact Mass | 173.11 |
| IUPAC Name | N-[(2R)-2,3-dihydroxypropyl]cyclobutanecarboxamide |
| SMILES | O=C(NC[C@@H](O)CO)C1CCC1 |
| InChI | InChI=1S/C8H15NO3/c10-5-7(11)4-9-8(12)6-2-1-3-6/h6-7,10-11H,1-5H2,(H,9,12)/t7-/m1/s1 |
| InChIKey | KDKBPNDRTUOYCL-SSDOTTSWSA-N |
| XLogP | -0.74 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.21 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |