C14H19BrN2O3S — CID 107071488
1-[(5-bromothiophen-3-yl)methyl-methylcarbamoyl]-3-methylpiperidine-2-carboxylic acid (PubChem CID 107071488) has the molecular formula C14H19BrN2O3S and a molecular weight of 375.29 g/mol. Its IUPAC name is 1-[(5-bromothiophen-3-yl)methyl-methylcarbamoyl]-3-methylpiperidine-2-carboxylic acid.
| Compound Name | 1-[(5-bromothiophen-3-yl)methyl-methylcarbamoyl]-3-methylpiperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 107071488 |
| Molecular Formula | C14H19BrN2O3S |
| Molecular Weight | 375.29 g/mol |
| Exact Mass | 374.03 |
| IUPAC Name | 1-[(5-bromothiophen-3-yl)methyl-methylcarbamoyl]-3-methylpiperidine-2-carboxylic acid |
| SMILES | CC1CCCN(C(=O)N(C)Cc2csc(Br)c2)C1C(=O)O |
| InChI | InChI=1S/C14H19BrN2O3S/c1-9-4-3-5-17(12(9)13(18)19)14(20)16(2)7-10-6-11(15)21-8-10/h6,8-9,12H,3-5,7H2,1-2H3,(H,18,19) |
| InChIKey | NYYNJYLWRMSPDD-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.29 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |