C17H21NO2 — CID 10707268
(2S,5Z)-5-(2-methylpropylidene)-3-phenyl-2-propan-2-yl-2H-1,4-oxazin-6-one (PubChem CID 10707268) has the molecular formula C17H21NO2 and a molecular weight of 271.36 g/mol. Its IUPAC name is (2S,5Z)-5-(2-methylpropylidene)-3-phenyl-2-propan-2-yl-2H-1,4-oxazin-6-one.
| Compound Name | (2S,5Z)-5-(2-methylpropylidene)-3-phenyl-2-propan-2-yl-2H-1,4-oxazin-6-one |
|---|---|
| PubChem CID | 10707268 |
| Molecular Formula | C17H21NO2 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | (2S,5Z)-5-(2-methylpropylidene)-3-phenyl-2-propan-2-yl-2H-1,4-oxazin-6-one |
| SMILES | CC(C)/C=C1\N=C(c2ccccc2)[C@H](C(C)C)OC1=O |
| InChI | InChI=1S/C17H21NO2/c1-11(2)10-14-17(19)20-16(12(3)4)15(18-14)13-8-6-5-7-9-13/h5-12,16H,1-4H3/b14-10-/t16-/m0/s1 |
| InChIKey | LNVVTHZEJMRLDD-DNXIFWLFSA-N |
| XLogP | 3.60 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|