C20H16F3NO3 — CID 44521900
ethyl 2,3-diphenyl-6-(trifluoromethyl)-2H-1,4-oxazine-5-carboxylate (PubChem CID 44521900) has the molecular formula C20H16F3NO3 and a molecular weight of 375.35 g/mol. Its IUPAC name is ethyl 2,3-diphenyl-6-(trifluoromethyl)-2H-1,4-oxazine-5-carboxylate.
| Compound Name | ethyl 2,3-diphenyl-6-(trifluoromethyl)-2H-1,4-oxazine-5-carboxylate |
|---|---|
| PubChem CID | 44521900 |
| Molecular Formula | C20H16F3NO3 |
| Molecular Weight | 375.35 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | ethyl 2,3-diphenyl-6-(trifluoromethyl)-2H-1,4-oxazine-5-carboxylate |
| SMILES | CCOC(=O)C1=C(C(F)(F)F)OC(c2ccccc2)C(c2ccccc2)=N1 |
| InChI | InChI=1S/C20H16F3NO3/c1-2-26-19(25)16-18(20(21,22)23)27-17(14-11-7-4-8-12-14)15(24-16)13-9-5-3-6-10-13/h3-12,17H,2H2,1H3 |
| InChIKey | LRIRCTGBEIFDMU-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.35 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |