C20H16F3NO3 — CID 138970647
ethyl (2Z)-2-[5-phenyl-3-[4-(trifluoromethyl)phenyl]-1,2-oxazol-4-ylidene]acetate (PubChem CID 138970647) has the molecular formula C20H16F3NO3 and a molecular weight of 375.35 g/mol. Its IUPAC name is ethyl (2Z)-2-[5-phenyl-3-[4-(trifluoromethyl)phenyl]-1,2-oxazol-4-ylidene]acetate.
| Compound Name | ethyl (2Z)-2-[5-phenyl-3-[4-(trifluoromethyl)phenyl]-1,2-oxazol-4-ylidene]acetate |
|---|---|
| PubChem CID | 138970647 |
| Molecular Formula | C20H16F3NO3 |
| Molecular Weight | 375.35 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | ethyl (2Z)-2-[5-phenyl-3-[4-(trifluoromethyl)phenyl]-1,2-oxazol-4-ylidene]acetate |
| SMILES | CCOC(=O)/C=C1/C(c2ccc(C(F)(F)F)cc2)=NOC1c1ccccc1 |
| InChI | InChI=1S/C20H16F3NO3/c1-2-26-17(25)12-16-18(13-8-10-15(11-9-13)20(21,22)23)24-27-19(16)14-6-4-3-5-7-14/h3-12,19H,2H2,1H3/b16-12- |
| InChIKey | ALVPJLAFHBXYLS-VBKFSLOCSA-N |
| XLogP | 4.67 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.35 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|