C13H16N2O5 — CID 107075785
methyl 4-(4-amino-3-hydroxybenzoyl)morpholine-2-carboxylate (PubChem CID 107075785) has the molecular formula C13H16N2O5 and a molecular weight of 280.28 g/mol. Its IUPAC name is methyl 4-(4-amino-3-hydroxybenzoyl)morpholine-2-carboxylate.
| Compound Name | methyl 4-(4-amino-3-hydroxybenzoyl)morpholine-2-carboxylate |
|---|---|
| PubChem CID | 107075785 |
| Molecular Formula | C13H16N2O5 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | methyl 4-(4-amino-3-hydroxybenzoyl)morpholine-2-carboxylate |
| SMILES | COC(=O)C1CN(C(=O)c2ccc(N)c(O)c2)CCO1 |
| InChI | InChI=1S/C13H16N2O5/c1-19-13(18)11-7-15(4-5-20-11)12(17)8-2-3-9(14)10(16)6-8/h2-3,6,11,16H,4-5,7,14H2,1H3 |
| InChIKey | VUEYIMZRHXBRLZ-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 102.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|