C14H18N2O4 — CID 107075695
methyl 1-(4-amino-3-hydroxybenzoyl)-4-methylpyrrolidine-3-carboxylate (PubChem CID 107075695) has the molecular formula C14H18N2O4 and a molecular weight of 278.31 g/mol. Its IUPAC name is methyl 1-(4-amino-3-hydroxybenzoyl)-4-methylpyrrolidine-3-carboxylate.
| Compound Name | methyl 1-(4-amino-3-hydroxybenzoyl)-4-methylpyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 107075695 |
| Molecular Formula | C14H18N2O4 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | methyl 1-(4-amino-3-hydroxybenzoyl)-4-methylpyrrolidine-3-carboxylate |
| SMILES | COC(=O)C1CN(C(=O)c2ccc(N)c(O)c2)CC1C |
| InChI | InChI=1S/C14H18N2O4/c1-8-6-16(7-10(8)14(19)20-2)13(18)9-3-4-11(15)12(17)5-9/h3-5,8,10,17H,6-7,15H2,1-2H3 |
| InChIKey | PRLXTMPVNYXDSC-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 92.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|