C13H15FN2O3 — CID 115694818
methyl 1-(5-fluoropyridine-3-carbonyl)-4-methylpyrrolidine-3-carboxylate (PubChem CID 115694818) has the molecular formula C13H15FN2O3 and a molecular weight of 266.27 g/mol. Its IUPAC name is methyl 1-(5-fluoropyridine-3-carbonyl)-4-methylpyrrolidine-3-carboxylate.
| Compound Name | methyl 1-(5-fluoropyridine-3-carbonyl)-4-methylpyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 115694818 |
| Molecular Formula | C13H15FN2O3 |
| Molecular Weight | 266.27 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | methyl 1-(5-fluoropyridine-3-carbonyl)-4-methylpyrrolidine-3-carboxylate |
| SMILES | COC(=O)C1CN(C(=O)c2cncc(F)c2)CC1C |
| InChI | InChI=1S/C13H15FN2O3/c1-8-6-16(7-11(8)13(18)19-2)12(17)9-3-10(14)5-15-4-9/h3-5,8,11H,6-7H2,1-2H3 |
| InChIKey | UHWOBRHUSSCPGV-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.27 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |