C15H20N2O4 — CID 81094450
methyl 1-(3-amino-5-methoxybenzoyl)-4-methylpyrrolidine-3-carboxylate (PubChem CID 81094450) has the molecular formula C15H20N2O4 and a molecular weight of 292.33 g/mol. Its IUPAC name is methyl 1-(3-amino-5-methoxybenzoyl)-4-methylpyrrolidine-3-carboxylate.
| Compound Name | methyl 1-(3-amino-5-methoxybenzoyl)-4-methylpyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 81094450 |
| Molecular Formula | C15H20N2O4 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | methyl 1-(3-amino-5-methoxybenzoyl)-4-methylpyrrolidine-3-carboxylate |
| SMILES | COC(=O)C1CN(C(=O)c2cc(N)cc(OC)c2)CC1C |
| InChI | InChI=1S/C15H20N2O4/c1-9-7-17(8-13(9)15(19)21-3)14(18)10-4-11(16)6-12(5-10)20-2/h4-6,9,13H,7-8,16H2,1-3H3 |
| InChIKey | URUKFNKTMFIKJM-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|