C9H13N3O2 — CID 107075849
2-amino-5-hydroxy-N',N'-dimethylbenzohydrazide (PubChem CID 107075849) has the molecular formula C9H13N3O2 and a molecular weight of 195.22 g/mol. Its IUPAC name is 2-amino-5-hydroxy-N',N'-dimethylbenzohydrazide.
| Compound Name | 2-amino-5-hydroxy-N',N'-dimethylbenzohydrazide |
|---|---|
| PubChem CID | 107075849 |
| Molecular Formula | C9H13N3O2 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.10 |
| IUPAC Name | 2-amino-5-hydroxy-N',N'-dimethylbenzohydrazide |
| SMILES | CN(C)NC(=O)c1cc(O)ccc1N |
| InChI | InChI=1S/C9H13N3O2/c1-12(2)11-9(14)7-5-6(13)3-4-8(7)10/h3-5,13H,10H2,1-2H3,(H,11,14) |
| InChIKey | HXDAEIZJXLCQOQ-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 78.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|