About 2-amino-5-hydroxy-N-methylbenzamide;ethane;prop-1-yne
2-amino-5-hydroxy-N-methylbenzamide;ethane;prop-1-yne (PubChem CID 143940504) has the molecular formula C13H20N2O2
and a molecular weight of 236.31 g/mol. Its IUPAC name is 2-amino-5-hydroxy-N-methylbenzamide;ethane;prop-1-yne.
Molecular Properties
| Compound Name | 2-amino-5-hydroxy-N-methylbenzamide;ethane;prop-1-yne |
| PubChem CID | 143940504 |
| Molecular Formula | C13H20N2O2 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.15 |
| IUPAC Name | 2-amino-5-hydroxy-N-methylbenzamide;ethane;prop-1-yne |
| SMILES | C#CC.CC.CNC(=O)c1cc(O)ccc1N |
| InChI | InChI=1S/C8H10N2O2.C3H4.C2H6/c1-10-8(12)6-4-5(11)2-3-7(6)9;1-3-2;1-2/h2-4,11H,9H2,1H3,(H,10,12);1H,2H3;1-2H3 |
| InChIKey | CVZMAMGUOQWRGY-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-5-hydroxy-N-methylbenzamide;ethane;prop-1-yne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-5-hydroxy-N-methylbenzamide;ethane;prop-1-yne?
The IUPAC name of 2-amino-5-hydroxy-N-methylbenzamide;ethane;prop-1-yne (CID 143940504) is 2-amino-5-hydroxy-N-methylbenzamide;ethane;prop-1-yne.
What is the SMILES notation for 2-amino-5-hydroxy-N-methylbenzamide;ethane;prop-1-yne?
The canonical SMILES for 2-amino-5-hydroxy-N-methylbenzamide;ethane;prop-1-yne is C#CC.CC.CNC(=O)c1cc(O)ccc1N.
What is the InChIKey of 2-amino-5-hydroxy-N-methylbenzamide;ethane;prop-1-yne?
The InChIKey is CVZMAMGUOQWRGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O2.C3H4.C2H6/c1-10-8(12)6-4-5(11)2-3-7(6)9;1-3-2;1-2/h2-4,11H,9H2,1H3,(H,10,12);1H,2H3;1-2H3.
What are the key properties of 2-amino-5-hydroxy-N-methylbenzamide;ethane;prop-1-yne?
2-amino-5-hydroxy-N-methylbenzamide;ethane;prop-1-yne has a molecular weight of 236.31 g/mol, XLogP of 2.00, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-5-hydroxy-N-methylbenzamide;ethane;prop-1-yne is sourced from PubChem (CID 143940504), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).