C13H15BrN4S — CID 107078044
4-bromo-2-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethylsulfanyl)aniline (PubChem CID 107078044) has the molecular formula C13H15BrN4S and a molecular weight of 339.26 g/mol. Its IUPAC name is 4-bromo-2-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethylsulfanyl)aniline.
| Compound Name | 4-bromo-2-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethylsulfanyl)aniline |
|---|---|
| PubChem CID | 107078044 |
| Molecular Formula | C13H15BrN4S |
| Molecular Weight | 339.26 g/mol |
| Exact Mass | 338.02 |
| IUPAC Name | 4-bromo-2-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethylsulfanyl)aniline |
| SMILES | Nc1ccc(Br)cc1SCc1nnc2n1CCCC2 |
| InChI | InChI=1S/C13H15BrN4S/c14-9-4-5-10(15)11(7-9)19-8-13-17-16-12-3-1-2-6-18(12)13/h4-5,7H,1-3,6,8,15H2 |
| InChIKey | UHHGHMCMKXZZAF-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.26 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|